N-[(2-bromo-4-methylphenyl)carbamothioyl]furan-2-carboxamide
Modify Date: 2024-04-03 16:37:39
![N-[(2-bromo-4-methylphenyl)carbamothioyl]furan-2-carboxamide Structure](https://image.chemsrc.com/caspic/140/5617-47-0.png)
N-[(2-bromo-4-methylphenyl)carbamothioyl]furan-2-carboxamide structure
|
Common Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5617-47-0 | Molecular Weight | 339.20800 | |
| Density | 1.586g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H11BrN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]furan-2-carboxamide |
|---|
| Density | 1.586g/cm3 |
|---|---|
| Molecular Formula | C13H11BrN2O2S |
| Molecular Weight | 339.20800 |
| Exact Mass | 337.97200 |
| PSA | 96.89000 |
| LogP | 4.27260 |
| Index of Refraction | 1.683 |
| InChIKey | QRHDEGHKIMEEKV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2ccco2)c(Br)c1 |
|
~85%
N-[(2-bromo-4-m... CAS#:5617-47-0 |
| Literature: Karunaratne; Hoveyda; Orvig Tetrahedron Letters, 1992 , vol. 33, # 14 p. 1827 - 1830 |
|
~%
N-[(2-bromo-4-m... CAS#:5617-47-0 |
| Literature: Hahn, F. Ekkehardt; Tamm, Matthias Journal of Organometallic Chemistry, 1994 , vol. 467, # 1 p. 103 - 112 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |