1-methyl-2-[4-(2-methylphenyl)sulfonylbut-2-ynylsulfonyl]benzene
Modify Date: 2025-10-15 15:12:10
![1-methyl-2-[4-(2-methylphenyl)sulfonylbut-2-ynylsulfonyl]benzene Structure](https://image.chemsrc.com/caspic/471/56163-36-1.png)
1-methyl-2-[4-(2-methylphenyl)sulfonylbut-2-ynylsulfonyl]benzene structure
|
Common Name | 1-methyl-2-[4-(2-methylphenyl)sulfonylbut-2-ynylsulfonyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 56163-36-1 | Molecular Weight | 362.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-2-[4-(2-methylphenyl)sulfonylbut-2-ynylsulfonyl]benzene |
|---|
| Molecular Formula | C18H18O4S2 |
|---|---|
| Molecular Weight | 362.46300 |
| Exact Mass | 362.06500 |
| PSA | 85.04000 |
| LogP | 4.71600 |
| InChIKey | KKQCRNHWMOSPDB-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1S(=O)(=O)CC#CCS(=O)(=O)c1ccccc1C |
|
~%
1-methyl-2-[4-(... CAS#:56163-36-1 |
| Literature: Thyagarajan,B.S. et al. Journal of Heterocyclic Chemistry, 1975 , vol. 12, p. 59 - 66 |
|
~%
1-methyl-2-[4-(... CAS#:56163-36-1 |
| Literature: Thyagarajan,B.S. et al. Journal of Heterocyclic Chemistry, 1975 , vol. 12, p. 59 - 66 |
![Benzene,1,1'-[2-butyne-1,4-diylbis(thio)]bis[2-methyl-(9CI) structure](https://image.chemsrc.com/caspic/171/56163-31-6.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |