Furo[3,2-b]pyridine-2,3-dicarboxylicacid, 6-chloro-, 2,3-dimethyl ester structure
|
Common Name | Furo[3,2-b]pyridine-2,3-dicarboxylicacid, 6-chloro-, 2,3-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 56159-18-3 | Molecular Weight | 269.63800 | |
| Density | 1.439g/cm3 | Boiling Point | 332.3ºC at 760mmHg | |
| Molecular Formula | C11H8ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.8ºC | |
| Name | dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 332.3ºC at 760mmHg |
| Molecular Formula | C11H8ClNO5 |
| Molecular Weight | 269.63800 |
| Flash Point | 154.8ºC |
| Exact Mass | 269.00900 |
| PSA | 78.63000 |
| LogP | 2.05440 |
| Index of Refraction | 1.586 |
| InChIKey | FSHAREYYOCEUHL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1oc2cc(Cl)cnc2c1C(=O)OC |
|
~%
Furo[3,2-b]pyri... CAS#:56159-18-3 |
| Literature: Abramovitch,R.A.; Shinkai,I. Journal of the American Chemical Society, 1975 , vol. 97, p. 3227 - 3229 |
|
~%
Furo[3,2-b]pyri... CAS#:56159-18-3 |
| Literature: Abramovitch,R.A.; Shinkai,I. Journal of the American Chemical Society, 1975 , vol. 97, p. 3227 - 3229 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-chloro-furo[3,2-b]pyridine-2,3-dicarboxylic acid dimethyl ester |