methyl 2-(3-phenylmethoxycarbonylaminopropanoylamino)propanoate structure
|
Common Name | methyl 2-(3-phenylmethoxycarbonylaminopropanoylamino)propanoate | ||
|---|---|---|---|---|
| CAS Number | 56120-14-0 | Molecular Weight | 308.33000 | |
| Density | 1.186g/cm3 | Boiling Point | 512.3ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.6ºC | |
| Name | methyl 2-[3-(phenylmethoxycarbonylamino)propanoylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 512.3ºC at 760 mmHg |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33000 |
| Flash Point | 263.6ºC |
| Exact Mass | 308.13700 |
| PSA | 93.73000 |
| LogP | 1.76240 |
| Index of Refraction | 1.519 |
| InChIKey | CJZOYKZYPHUDRB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)NC(=O)CCNC(=O)OCc1ccccc1 |
|
~93%
methyl 2-(3-phe... CAS#:56120-14-0 |
| Literature: Kasafirek, Evzen; Fric, Premysl; Slaby, Jan Collection of Czechoslovak Chemical Communications, 1987 , vol. 52, # 6 p. 1625 - 1633 |
|
~%
methyl 2-(3-phe... CAS#:56120-14-0 |
| Literature: Okada; Iguchi; Okinaka; Yagyu; Sano; Otani Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, # 11 p. 3588 - 3591 |
| methyl 2-(3-phenylmethoxycarbonylaminopropanoylamino)propanoate |