Furodazole structure
|
Common Name | Furodazole | ||
|---|---|---|---|---|
| CAS Number | 56119-96-1 | Molecular Weight | 265.26700 | |
| Density | 1.368g/cm3 | Boiling Point | 513.7ºC at 760 mmHg | |
| Molecular Formula | C15H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.5ºC | |
| Name | 2-(furan-2-yl)-7-methyl-3,6-dihydroimidazo[4,5-f]quinolin-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 513.7ºC at 760 mmHg |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.26700 |
| Flash Point | 264.5ºC |
| Exact Mass | 265.08500 |
| PSA | 74.94000 |
| LogP | 3.38510 |
| Index of Refraction | 1.682 |
| InChIKey | NYRSQWAKUMYFLI-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2c(ccc3[nH]c(-c4ccco4)nc32)[nH]1 |
|
~%
Furodazole CAS#:56119-96-1 |
| Literature: Alaimo,R.J. et al. Journal of Medicinal Chemistry, 1978 , vol. 21, p. 298 - 300 |
|
~%
Furodazole CAS#:56119-96-1 |
| Literature: Alaimo,R.J. et al. Journal of Medicinal Chemistry, 1978 , vol. 21, p. 298 - 300 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| F-691 |
| Furodazole anhydrous |
| Furodazole |
| Furodazole (USAN/INN) |
| 2-(2-Furyl)-7-methyl-1H-imidazo[4,5-f]quinolin-9-ol |
| 2-furan-2-yl-7-methyl-1(3),6-dihydro-imidazo[4,5-f]quinolin-9-one |
| UNII-5B6I19ZE0R |
| UNII-9745E7HEBG |