2-(benzenecarboximidoyl)-4-chloro-N-methylaniline structure
|
Common Name | 2-(benzenecarboximidoyl)-4-chloro-N-methylaniline | ||
|---|---|---|---|---|
| CAS Number | 5606-40-6 | Molecular Weight | 244.71900 | |
| Density | 1.16g/cm3 | Boiling Point | 396.7ºC at 760 mmHg | |
| Molecular Formula | C14H13ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.7ºC | |
| Name | 2-(benzenecarboximidoyl)-4-chloro-N-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 396.7ºC at 760 mmHg |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.71900 |
| Flash Point | 193.7ºC |
| Exact Mass | 244.07700 |
| PSA | 35.88000 |
| LogP | 3.97060 |
| Index of Refraction | 1.591 |
| InChIKey | YIBUYDHSWMGPBG-UHFFFAOYSA-N |
| SMILES | CNc1ccc(Cl)cc1C(=N)c1ccccc1 |
|
~76%
2-(benzenecarbo... CAS#:5606-40-6 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4141895 A1, 1979 ; |
|
~62%
2-(benzenecarbo... CAS#:5606-40-6 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4141895 A1, 1979 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Menh-5-Cl-phcoph imine |
| 5-chloro-2-methylaminobenzophenone imine |
| Aniline,2-benzimidoyl-4-chloro-N-methyl |
| 2-methylamino-5-chlorobenzophenone imine |