6-Chloro-5-nitro-2-picoline structure
|
Common Name | 6-Chloro-5-nitro-2-picoline | ||
|---|---|---|---|---|
| CAS Number | 56057-19-3 | Molecular Weight | 172.569 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 255.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H5ClN2O2 | Melting Point | 70-74 °C | |
| MSDS | N/A | Flash Point | 108.5±25.9 °C | |
| Name | 2-Chloro-3-Nitro-6-Methylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 255.9±35.0 °C at 760 mmHg |
| Melting Point | 70-74 °C |
| Molecular Formula | C6H5ClN2O2 |
| Molecular Weight | 172.569 |
| Flash Point | 108.5±25.9 °C |
| Exact Mass | 172.003952 |
| PSA | 58.71000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | UIEVSGOVFXWCIK-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(Cl)n1 |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26 |
| HS Code | 2933399090 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 6-chloro-2-methyl-3-nitro- |
| 6-Chloro-2-methyl-3-nitropyridine |
| 2-Chloro-6-methyl-3-nitropyridine |
| 2-Chloro-5-nitro-6-picoline |
| T6NJ B1 CNW FG |
| MFCD03085820 |