2-(carboxymethyl-octyl-amino)acetic acid
Modify Date: 2025-08-30 23:08:50
2-(carboxymethyl-octyl-amino)acetic acid structure
|
Common Name | 2-(carboxymethyl-octyl-amino)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 56004-53-6 | Molecular Weight | 245.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[carboxymethyl(octyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H23NO4 |
|---|---|
| Molecular Weight | 245.31500 |
| Exact Mass | 245.16300 |
| PSA | 77.84000 |
| LogP | 1.81810 |
| InChIKey | IHWFWYCNJLFHPC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN(CC(=O)O)CC(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
2-(carboxymethy... CAS#:56004-53-6 |
| Literature: Stein et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 191 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Bis-carboxymethyl-octyl-amin |
| Octylimino-di-essigsaeure |
| 2-[(carboxymethyl)octylamino]acetic acid |
| octylimino-di-acetic acid |
| 2,2'-(octylimino)diacetic acid |