1,5-Pentanediyl Bismethanethiosulfonate
Modify Date: 2025-08-25 20:08:14
1,5-Pentanediyl Bismethanethiosulfonate structure
|
Common Name | 1,5-Pentanediyl Bismethanethiosulfonate | ||
|---|---|---|---|---|
| CAS Number | 56-00-8 | Molecular Weight | 292.46000 | |
| Density | 1.366g/cm3 | Boiling Point | 529.5ºC at 760 mmHg | |
| Molecular Formula | C7H16O4S4 | Melting Point | 71-72ºC | |
| MSDS | N/A | Flash Point | 274ºC | |
| Name | 1,5-bis(methylsulfonylsulfanyl)pentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 529.5ºC at 760 mmHg |
| Melting Point | 71-72ºC |
| Molecular Formula | C7H16O4S4 |
| Molecular Weight | 292.46000 |
| Flash Point | 274ºC |
| Exact Mass | 291.99300 |
| PSA | 135.64000 |
| LogP | 3.70390 |
| Index of Refraction | 1.549 |
| InChIKey | PFGFBHYQVVHELE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCCCCCSS(C)(=O)=O |
|
~%
1,5-Pentanediyl... CAS#:56-00-8 |
| Literature: EP966304 B1, ; Page/Page column 20 ; |
|
~%
1,5-Pentanediyl... CAS#:56-00-8 |
| Literature: Chemical and pharmaceutical bulletin, , vol. 12, # 11 p. 1271 - 1276 |
|
~%
1,5-Pentanediyl... CAS#:56-00-8 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 33, p. 1980 - 1983,1926 - 1928 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Dimethanesulfonylthiopentane |
| Methanesulfonothioic acid S,S'-1,5-pentanediyl ester |
| MTS-5-MTS |
| Pentamethylene bismethanethiosulfonate |
| 1,5-Bis-methansulfonylthio-pentan |
| 1,5-Pentanediyl Bismethanethiosulfonate |
| Preparation 335 |