2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(benzo[b]thien-3-ylmethylene)-
Modify Date: 2025-09-27 12:11:18
![2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(benzo[b]thien-3-ylmethylene)- Structure](https://image.chemsrc.com/caspic/194/5592-03-0.png)
2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(benzo[b]thien-3-ylmethylene)- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(benzo[b]thien-3-ylmethylene)- | ||
|---|---|---|---|---|
| CAS Number | 5592-03-0 | Molecular Weight | 272.27900 | |
| Density | 1.517g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H8N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(1-benzothiophen-3-ylmethylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.517g/cm3 |
|---|---|
| Molecular Formula | C13H8N2O3S |
| Molecular Weight | 272.27900 |
| Exact Mass | 272.02600 |
| PSA | 103.51000 |
| LogP | 2.30830 |
| Index of Refraction | 1.74 |
| InChIKey | KYUZIHNLKUMCRA-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(=Cc2csc3ccccc23)C(=O)N1 |
|
~%
2,4,6(1H,3H,5H)... CAS#:5592-03-0 |
| Literature: Campaigne,E.; Neiss,E.S. Journal of Heterocyclic Chemistry, 1966 , vol. 3, p. 46 - 50 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(Thionaphthen-3-methin)-barbitursaeure |
| 5-benzo[b]thiophen-3-ylmethylene-pyrimidine-2,4,6-trione |
| 5-(3-Benzo<b>thenyliden)-barbitursaeure |
| 5-(1-benzothiophen-3-ylmethylidene)pyrimidine-2,4,6(1h,3h,5h)-trione |