[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate structure
|
Common Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate | ||
|---|---|---|---|---|
| CAS Number | 5589-86-6 | Molecular Weight | 540.97900 | |
| Density | 1.5g/cm3 | Boiling Point | 726.2ºC at 760 mmHg | |
| Molecular Formula | C24H21ClN6O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 393ºC | |
| Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 726.2ºC at 760 mmHg |
| Molecular Formula | C24H21ClN6O5S |
| Molecular Weight | 540.97900 |
| Flash Point | 393ºC |
| Exact Mass | 540.09800 |
| PSA | 169.40000 |
| LogP | 2.66670 |
| Index of Refraction | 1.702 |
| InChIKey | DDOJOVCRVIOJOB-UHFFFAOYSA-N |
| SMILES | Cn1c(N)c(C(=O)COC(=O)CSc2nnc(-c3ccccc3)n2-c2ccc(Cl)cc2)c(=O)n(C)c1=O |
|
~%
[2-(4-amino-1,3... CAS#:5589-86-6 |
| Literature: McCall; Millward Journal of the Chemical Society, 1959 , p. 1911 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-cyano-2-methyl-valeric acid |
| 5-Cyan-2-methyl-valeriansaeure |