N-[2-[(2,6-dichlorophenyl)amino]pyridin-3-yl]sulfonylpropanamide
Modify Date: 2025-10-06 22:58:17
![N-[2-[(2,6-dichlorophenyl)amino]pyridin-3-yl]sulfonylpropanamide Structure](https://image.chemsrc.com/caspic/018/55841-95-7.png)
N-[2-[(2,6-dichlorophenyl)amino]pyridin-3-yl]sulfonylpropanamide structure
|
Common Name | N-[2-[(2,6-dichlorophenyl)amino]pyridin-3-yl]sulfonylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 55841-95-7 | Molecular Weight | 374.24200 | |
| Density | 1.477g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H13Cl2N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(2,6-dichloroanilino)pyridin-3-yl]sulfonylpropanamide |
|---|
| Density | 1.477g/cm3 |
|---|---|
| Molecular Formula | C14H13Cl2N3O3S |
| Molecular Weight | 374.24200 |
| Exact Mass | 373.00500 |
| PSA | 96.54000 |
| LogP | 4.89160 |
| Index of Refraction | 1.62 |
| InChIKey | DPLMGKFGIIZAEA-UHFFFAOYSA-N |
| SMILES | CCC(=O)NS(=O)(=O)c1cccnc1Nc1c(Cl)cccc1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |