5-((Phenylsulfinyl)methyl)-1,3-benzodioxole structure
|
Common Name | 5-((Phenylsulfinyl)methyl)-1,3-benzodioxole | ||
|---|---|---|---|---|
| CAS Number | 55815-82-2 | Molecular Weight | 260.30800 | |
| Density | 1.39g/cm3 | Boiling Point | 461.7ºC at 760 mmHg | |
| Molecular Formula | C14H12O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233ºC | |
| Name | 5-(benzenesulfinylmethyl)-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 461.7ºC at 760 mmHg |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.30800 |
| Flash Point | 233ºC |
| Exact Mass | 260.05100 |
| PSA | 54.74000 |
| LogP | 3.58880 |
| Index of Refraction | 1.686 |
| InChIKey | AUIUSBNFCZAULP-UHFFFAOYSA-N |
| SMILES | O=S(Cc1ccc2c(c1)OCO2)c1ccccc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-((Phenylsulfinyl)methyl)-1,3-benzodioxole |
| 1,3-Benzodioxol-5-ylmethyl phenyl sulfoxide |