5-Bromo-1,3-dichloro-2-(4-methoxyphenoxy)benzene
Modify Date: 2025-09-11 19:20:57
5-Bromo-1,3-dichloro-2-(4-methoxyphenoxy)benzene structure
|
Common Name | 5-Bromo-1,3-dichloro-2-(4-methoxyphenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 55814-63-6 | Molecular Weight | 348.01900 | |
| Density | 1.553g/cm3 | Boiling Point | 359.348ºC at 760 mmHg | |
| Molecular Formula | C13H9BrCl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.128ºC | |
| Name | 5-Bromo-1,3-dichloro-2-(4-methoxyphenoxy)benzene |
|---|
| Density | 1.553g/cm3 |
|---|---|
| Boiling Point | 359.348ºC at 760 mmHg |
| Molecular Formula | C13H9BrCl2O2 |
| Molecular Weight | 348.01900 |
| Flash Point | 171.128ºC |
| Exact Mass | 345.91600 |
| PSA | 18.46000 |
| LogP | 5.55680 |
| Index of Refraction | 1.602 |
| InChIKey | KGHTYPVKRDRRBL-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2c(Cl)cc(Br)cc2Cl)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |