N-(3-ethoxyphenyl)-2-methylbenzamide
Modify Date: 2025-11-27 17:23:23
N-(3-ethoxyphenyl)-2-methylbenzamide structure
|
Common Name | N-(3-ethoxyphenyl)-2-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 55814-38-5 | Molecular Weight | 255.31200 | |
| Density | 1.134g/cm3 | Boiling Point | 329.8ºC at 760 mmHg | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.2ºC | |
| Name | N-(3-ethoxyphenyl)-2-methylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 329.8ºC at 760 mmHg |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.31200 |
| Flash Point | 153.2ºC |
| Exact Mass | 255.12600 |
| PSA | 41.82000 |
| LogP | 4.03000 |
| Index of Refraction | 1.599 |
| InChIKey | GMDMMUVZXYVYIM-UHFFFAOYSA-N |
| SMILES | CCOc1cccc(NC(=O)c2ccccc2C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-Aethoxy-2-methylbenzanilid |