Triisocyanato(methoxy)silane
Modify Date: 2025-08-25 12:26:52
Triisocyanato(methoxy)silane structure
|
Common Name | Triisocyanato(methoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 5578-37-0 | Molecular Weight | 185.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H3N3O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triisocyanatomethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H3N3O4Si |
|---|---|
| Molecular Weight | 185.17000 |
| Exact Mass | 184.98900 |
| PSA | 97.52000 |
| InChIKey | JFNBSSORJWMRMS-UHFFFAOYSA-N |
| SMILES | O=C=NC(N=C=O)(N=C=O)O[Si] |
|
~15%
Triisocyanato(m... CAS#:5578-37-0 |
| Literature: Gmelin Handbook: Si: MVol.C, 136, page 377 - 379 |
|
~%
Triisocyanato(m... CAS#:5578-37-0 |
| Literature: Forbes; Anderson Journal of the American Chemical Society, 1944 , vol. 66, p. 1706 |
|
~%
Detail
|
| Literature: Forbes; Anderson Journal of the American Chemical Society, 1944 , vol. 66, p. 1706 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| triisocyanato-methoxy-silane |
| Siliciummethoxytriisocyanat |
| methoxysilyl triisocyanate |
| Silane,triisocyanatomethoxy |
| Triisocyanato-methoxy-silan |
| silicon methoxy triisocyanate |