n-(tert-butoxycarbonyl)-l-cysteine methyl ester
Modify Date: 2025-08-26 19:22:42
n-(tert-butoxycarbonyl)-l-cysteine methyl ester structure
|
Common Name | n-(tert-butoxycarbonyl)-l-cysteine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 55757-46-5 | Molecular Weight | 235.30100 | |
| Density | 1.143 g/mL at 25ºC(lit.) | Boiling Point | 214ºC(lit.) | |
| Molecular Formula | C9H17NO4S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 113 °C | |
| Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 214ºC(lit.) |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30100 |
| Flash Point | 113 °C |
| Exact Mass | 235.08800 |
| PSA | 103.43000 |
| LogP | 1.37340 |
| Index of Refraction | n20/D 1.475(lit.) |
| InChIKey | NJGIAKIPSDCYAC-LURJTMIESA-N |
| SMILES | COC(=O)C(CS)NC(=O)OC(C)(C)C |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2930909090 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(tert-Butoxycarbonyl)-L-cysteine methyl ester |
| MFCD00799495 |
| methyl N-BOC-L-cysteinate |