N-(4-methylphenyl)-2-[(2-piperidin-1-ylacetyl)amino]benzamide
Modify Date: 2025-09-26 21:31:57
![N-(4-methylphenyl)-2-[(2-piperidin-1-ylacetyl)amino]benzamide Structure](https://image.chemsrc.com/caspic/362/55740-33-5.png)
N-(4-methylphenyl)-2-[(2-piperidin-1-ylacetyl)amino]benzamide structure
|
Common Name | N-(4-methylphenyl)-2-[(2-piperidin-1-ylacetyl)amino]benzamide | ||
|---|---|---|---|---|
| CAS Number | 55740-33-5 | Molecular Weight | 351.44200 | |
| Density | 1.206g/cm3 | Boiling Point | 497.8ºC at 760 mmHg | |
| Molecular Formula | C21H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8ºC | |
| Name | N-(4-methylphenyl)-2-[(2-piperidin-1-ylacetyl)amino]benzamide |
|---|
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 497.8ºC at 760 mmHg |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.44200 |
| Flash Point | 254.8ºC |
| Exact Mass | 351.19500 |
| PSA | 64.93000 |
| LogP | 4.33210 |
| Index of Refraction | 1.637 |
| InChIKey | RZOBAKJSUXZZIY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)CN2CCCCC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |