(1-hydroxy-1-phenylpropan-2-yl)-propan-2-ylazanium,chloride
Modify Date: 2025-09-18 12:09:58
(1-hydroxy-1-phenylpropan-2-yl)-propan-2-ylazanium,chloride structure
|
Common Name | (1-hydroxy-1-phenylpropan-2-yl)-propan-2-ylazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 55688-37-4 | Molecular Weight | 229.74600 | |
| Density | N/A | Boiling Point | 284ºC at 760 mmHg | |
| Molecular Formula | C12H20ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 80.7ºC | |
| Name | (1-hydroxy-1-phenylpropan-2-yl)-propan-2-ylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 284ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.74600 |
| Flash Point | 80.7ºC |
| Exact Mass | 229.12300 |
| PSA | 32.26000 |
| LogP | 3.29940 |
| InChIKey | BNTXITGTFRZWPE-UHFFFAOYSA-N |
| SMILES | CC(C)[NH2+]C(C)C(O)c1ccccc1.[Cl-] |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-isopropylamino-1-phenyl-propan-1-ol,hydrochloride |