Methyl 2-fluoro-5-(trifluoromethyl)benzoate
Modify Date: 2025-08-27 10:04:09
Methyl 2-fluoro-5-(trifluoromethyl)benzoate structure
|
Common Name | Methyl 2-fluoro-5-(trifluoromethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 556112-92-6 | Molecular Weight | 222.136 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 216.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H6F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 82.5±22.2 °C | |
| Name | Methyl 2-fluoro-5-(trifluoromethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 216.4±40.0 °C at 760 mmHg |
| Molecular Formula | C9H6F4O2 |
| Molecular Weight | 222.136 |
| Flash Point | 82.5±22.2 °C |
| Exact Mass | 222.030396 |
| PSA | 26.30000 |
| LogP | 3.12 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.434 |
| InChIKey | UAEUYKATVUSDCK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(F)(F)F)ccc1F |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| FXFFR DF CVO1 |
| Methyl 2-fluoro-5-(trifluoromethyl)benzoate |
| Benzoic acid, 2-fluoro-5-(trifluoromethyl)-, methyl ester |