1-(4-nitrophenyl)-3a,8b-dihydroindeno[1,2-d]triazol-4-one
Modify Date: 2025-08-26 09:47:25
![1-(4-nitrophenyl)-3a,8b-dihydroindeno[1,2-d]triazol-4-one Structure](https://image.chemsrc.com/caspic/091/55507-29-4.png)
1-(4-nitrophenyl)-3a,8b-dihydroindeno[1,2-d]triazol-4-one structure
|
Common Name | 1-(4-nitrophenyl)-3a,8b-dihydroindeno[1,2-d]triazol-4-one | ||
|---|---|---|---|---|
| CAS Number | 55507-29-4 | Molecular Weight | 294.26500 | |
| Density | 1.6g/cm3 | Boiling Point | 494ºC at 760 mmHg | |
| Molecular Formula | C15H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
| Name | 1-(4-nitrophenyl)-3a,8b-dihydroindeno[1,2-d]triazol-4-one |
|---|
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 494ºC at 760 mmHg |
| Molecular Formula | C15H10N4O3 |
| Molecular Weight | 294.26500 |
| Flash Point | 252.6ºC |
| Exact Mass | 294.07500 |
| PSA | 90.85000 |
| LogP | 2.54760 |
| Index of Refraction | 1.798 |
| InChIKey | JPVUWGDVIHWPNW-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C2C1N=NN2c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |