magnesium benzene structure
|
Common Name | magnesium benzene | ||
|---|---|---|---|---|
| CAS Number | 555-54-4 | Molecular Weight | 178.51300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10Mg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | magnesium benzene |
|---|
| Molecular Formula | C12H10Mg |
|---|---|
| Molecular Weight | 178.51300 |
| Exact Mass | 178.06300 |
| LogP | 2.97360 |
| InChIKey | WRYKIHMRDIOPSI-UHFFFAOYSA-N |
| SMILES | [Mg+2].[c-]1ccccc1.[c-]1ccccc1 |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |