Benzenesulfonamide,N,N-dimethyl-4-[2-(4-morpholinyl)diazenyl]- structure
|
Common Name | Benzenesulfonamide,N,N-dimethyl-4-[2-(4-morpholinyl)diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 55469-82-4 | Molecular Weight | 298.36100 | |
| Density | 1.32g/cm3 | Boiling Point | 441.3ºC at 760 mmHg | |
| Molecular Formula | C12H18N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.7ºC | |
| Name | N,N-dimethyl-4-(morpholin-4-yldiazenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 441.3ºC at 760 mmHg |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.36100 |
| Flash Point | 220.7ºC |
| Exact Mass | 298.11000 |
| PSA | 82.95000 |
| LogP | 2.28650 |
| Index of Refraction | 1.605 |
| InChIKey | GSGYRTSTMSYUCW-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)c1ccc(N=NN2CCOCC2)cc1 |
|
~%
Benzenesulfonam... CAS#:55469-82-4 |
| Literature: Lalezari; Afghahi Journal of Pharmaceutical Sciences, 1975 , vol. 64, # 4 p. 698 - 699 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-dimethyl-4-morpholin-4-ylazo-benzenesulfonamide |