N-[2-(4-hydroxyphenyl)ethyl]pyridine-3-carboxamide structure
|
Common Name | N-[2-(4-hydroxyphenyl)ethyl]pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 55458-76-9 | Molecular Weight | 242.27300 | |
| Density | 1.219g/cm3 | Boiling Point | 535.3ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.6ºC | |
| Name | N-[2-(4-hydroxyphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 535.3ºC at 760 mmHg |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27300 |
| Flash Point | 277.6ºC |
| Exact Mass | 242.10600 |
| PSA | 65.71000 |
| LogP | 2.33450 |
| Index of Refraction | 1.611 |
| InChIKey | VSEZXJMDHJEHMN-UHFFFAOYSA-N |
| SMILES | O=C(NCCc1ccc(O)cc1)c1cccnc1 |
| HS Code | 2933399090 |
|---|
|
~%
N-[2-(4-hydroxy... CAS#:55458-76-9 |
| Literature: Rinderknecht Helvetica Chimica Acta, 1959 , vol. 42, p. 1324,1326 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Nicotinoyltyramine |
| marmamide-A |
| N-Nicotinoyltyramine |
| 3-Nicotinyltryptamine |