2'-O-MB-CAMP SODIUM SALT structure
|
Common Name | 2'-O-MB-CAMP SODIUM SALT | ||
|---|---|---|---|---|
| CAS Number | 55443-13-5 | Molecular Weight | 421.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17N5NaO7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-O-MB-CAMP SODIUM SALT2'-O-MB-cAMP (2'-O-Monobutyryl cyclic AM) sodium is an activatable prodrug of Cyclic AMP (HY-B1511)[1]. |
| Name | [6-(6-aminopurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl] butanoate,sodium |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-O-MB-cAMP (2'-O-Monobutyryl cyclic AM) sodium is an activatable prodrug of Cyclic AMP (HY-B1511)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H17N5NaO7P |
|---|---|
| Molecular Weight | 421.27800 |
| Exact Mass | 421.07600 |
| PSA | 173.55000 |
| LogP | 1.55300 |
| InChIKey | QSEXPGXXMNULPU-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1C2OP(=O)(O)OCC2OC1n1cnc2c(N)ncnc21.[Na] |
| WGK Germany | 3 |
|---|
| 2 inverted exclamation marka-O-Monobutyryladenosine 3 inverted exclamation marka:5 inverted exclamation marka-cyclic monophosphate sodium salt |