3-hydroxy-7-methoxy-N-(o-tolyl)naphthalene-2-carboxamide
Modify Date: 2025-08-26 17:01:23
3-hydroxy-7-methoxy-N-(o-tolyl)naphthalene-2-carboxamide structure
|
Common Name | 3-hydroxy-7-methoxy-N-(o-tolyl)naphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5538-57-8 | Molecular Weight | 307.34300 | |
| Density | 1.274g/cm3 | Boiling Point | 433.8ºC at 760 mmHg | |
| Molecular Formula | C19H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 3-hydroxy-7-methoxy-N-(o-tolyl)naphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760 mmHg |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.34300 |
| Flash Point | 216.2ºC |
| Exact Mass | 307.12100 |
| PSA | 58.56000 |
| LogP | 4.18770 |
| Index of Refraction | 1.688 |
| InChIKey | ISYIACJPZHHKAB-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(O)c(C(=O)Nc3ccccc3C)cc2c1 |
| HS Code | 2924299090 |
|---|
|
~%
3-hydroxy-7-met... CAS#:5538-57-8 |
| Literature: I.G.Farbenind. Patent: DE573723 , 1930 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 19, p. 785 Full Text Show Details Gen.Aniline Works Patent: US1935930 , 1931 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-hydroxy-7-methoxy-[2]naphthoic acid o-toluidide |
| 2'-methyl-3-hydroxy-7-methoxy-2-naphthanilide |
| 3-Hydroxy-7-methoxy-N-(2-methylphenyl)-2-naphthamide |
| Naphtanilide CB |
| Naphtanilide CB Supra |
| 2-Hydroxy-6-methoxy-N-(o-tolyl)-3-naphthalenecarboxamide |
| 3-Hydroxy-7-methoxy-[2]naphthoesaeure-o-toluidid |
| C.I.Azoic Coupling Component 111 |
| 2-NaphthalenecarboxaMide,3-hydroxy-7-Methoxy-N-(2-Methylphenyl) |