N-(Carboxymethyl)-N-(1,1-diphosphonoethyl)glycine
Modify Date: 2025-09-18 21:54:13
N-(Carboxymethyl)-N-(1,1-diphosphonoethyl)glycine structure
|
Common Name | N-(Carboxymethyl)-N-(1,1-diphosphonoethyl)glycine | ||
|---|---|---|---|---|
| CAS Number | 55339-20-3 | Molecular Weight | 321.11600 | |
| Density | 1.976g/cm3 | Boiling Point | 752.2ºC at 760 mmHg | |
| Molecular Formula | C6H13NO10P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 408.7ºC | |
| Name | 2-[carboxymethyl(1,1-diphosphonoethyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.976g/cm3 |
|---|---|
| Boiling Point | 752.2ºC at 760 mmHg |
| Molecular Formula | C6H13NO10P2 |
| Molecular Weight | 321.11600 |
| Flash Point | 408.7ºC |
| Exact Mass | 321.00100 |
| PSA | 212.52000 |
| Index of Refraction | 1.613 |
| InChIKey | PJXKZTFOBRSZOY-UHFFFAOYSA-N |
| SMILES | CC(N(CC(=O)O)CC(=O)O)(P(=O)(O)O)P(=O)(O)O |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N,N-Bis-carboxymethan-1-aminoethan-1,1-diphosphonsaeure |