6-Isoquinolineaceticacid, 2,3-dihydro-7-methyl-3-oxo-, ethyl ester
Modify Date: 2024-02-19 01:21:08
6-Isoquinolineaceticacid, 2,3-dihydro-7-methyl-3-oxo-, ethyl ester structure
|
Common Name | 6-Isoquinolineaceticacid, 2,3-dihydro-7-methyl-3-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 55329-69-6 | Molecular Weight | 245.27400 | |
| Density | 1.2g/cm3 | Boiling Point | 542.4ºC at 760 mmHg | |
| Molecular Formula | C14H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.8ºC | |
| Name | ethyl 2-(7-methyl-3-oxo-2H-isoquinolin-6-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 542.4ºC at 760 mmHg |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.27400 |
| Flash Point | 281.8ºC |
| Exact Mass | 245.10500 |
| PSA | 59.16000 |
| LogP | 1.94210 |
| Index of Refraction | 1.576 |
| InChIKey | XFFJHUZJYOTQQY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1cc2cc(=O)[nH]cc2cc1C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Carbethoxymethyl-3-hydroxy-7-methyl-isochinolin |