Prostaglandin F2α 1,9-lactone (PGF2α 1,9-lactone)
Modify Date: 2025-09-10 13:46:58
Prostaglandin F2α 1,9-lactone (PGF2α 1,9-lactone) structure
|
Common Name | Prostaglandin F2α 1,9-lactone (PGF2α 1,9-lactone) | ||
|---|---|---|---|---|
| CAS Number | 55314-48-2 | Molecular Weight | 336.466 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 496.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.5±22.2 °C | |
Use of Prostaglandin F2α 1,9-lactone (PGF2α 1,9-lactone)PGF2α 1,9-lactone is a lipid-soluble internal ester of PGF2α. |
| Name | 9alpha, 11alpha, 15s-trihydroxy-prosta-5z, 13e-dien-1-oic acid, 1,9-lactone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 496.6±45.0 °C at 760 mmHg |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.466 |
| Flash Point | 169.5±22.2 °C |
| Exact Mass | 336.230072 |
| PSA | 66.76000 |
| LogP | 2.76 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | ZVWMOTMHZYWJPF-WTKFZEAQSA-N |
| SMILES | CCCCCC(O)C=CC1C(O)CC2OC(=O)CCCC=CCC21 |
|
~%
Prostaglandin F... CAS#:55314-48-2 |
| Literature: Bundy; Peterson; Cornette; Miller; Spilman; Wilks Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1089 - 1099 |
|
~%
Prostaglandin F... CAS#:55314-48-2 |
| Literature: Bundy; Peterson; Cornette; Miller; Spilman; Wilks Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1089 - 1099 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Prosta-5,13-dien-1-one, 1,9-epoxy-11,15-dihydroxy-, (5Z,9β,11α,13E,15S)- |
| (5Z,9α,11α,13E,15S)-11,15-Dihydroxy-1,9-epoxyprosta-5,13-dien-1-one |
| (5Z,9β,11α,13E,15S)-11,15-Dihydroxy-1,9-epoxyprosta-5,13-dien-1-one |
| 9alpha,11alpha,15S-trihydroxy-prost-5Z,13E-dien-1-oic acid,1,9-lactone |
| PROSTAGLANDIN F2ALPHA 1,9-LACTONE |
| Prosta-5,13-dien-1-one, 1,9-epoxy-11,15-dihydroxy-, (5Z,9α,11α,13E,15S)- |