N1-(p-Chlorophenylthio)-N1-methyl-N2-(2,4-xylyl)formamidine
Modify Date: 2025-09-26 10:36:55
N1-(p-Chlorophenylthio)-N1-methyl-N2-(2,4-xylyl)formamidine structure
|
Common Name | N1-(p-Chlorophenylthio)-N1-methyl-N2-(2,4-xylyl)formamidine | ||
|---|---|---|---|---|
| CAS Number | 55311-62-1 | Molecular Weight | 304.83800 | |
| Density | 1.12g/cm3 | Boiling Point | 440ºC at 760 mmHg | |
| Molecular Formula | C16H17ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.9ºC | |
| Name | N-(4-chlorophenyl)sulfanyl-N'-(2,4-dimethylphenyl)-N-methylmethanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 440ºC at 760 mmHg |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.83800 |
| Flash Point | 219.9ºC |
| Exact Mass | 304.08000 |
| PSA | 40.90000 |
| LogP | 5.25570 |
| Index of Refraction | 1.581 |
| InChIKey | MZTDHAJDLGWQMR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=CN(C)Sc2ccc(Cl)cc2)c(C)c1 |
| HS Code | 2930909090 |
|---|
|
~%
N1-(p-Chlorophe... CAS#:55311-62-1 |
| Literature: Ciba-Geigy Patent: FR2262030DE2507814 , 19751975 ; Chem.Abstr., 1975 , vol. 83, # 205906 |
|
~%
N1-(p-Chlorophe... CAS#:55311-62-1 |
| Literature: The Upjohn Company Patent: US3954997 A1, 1976 ; |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| U-43,007 |
| N-methyl-N-(4-chlorophenylthio)-N'-2,4-xylyl formamidine |
| FORMAMIDINE,N-((p-CHLOROPHENYL)THIO)-N-METHYL-N'-(2,4-XYLYL) |
| N-((p-Chlorophenyl)thio)-N-methyl-N'-2,4-xylylformamidine |
| Benzenesulfenamide,4-chloro-N-(((2,4-dimethylphenyl)imino)methyl)-N-methyl |