Amoxecaine
Modify Date: 2025-08-25 18:32:47
Amoxecaine structure
|
Common Name | Amoxecaine | ||
|---|---|---|---|---|
| CAS Number | 553-65-1 | Molecular Weight | 307.43100 | |
| Density | 1.05g/cm3 | Boiling Point | 437ºC at 760mmHg | |
| Molecular Formula | C17H29N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1ºC | |
| Name | Amoxecaine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 437ºC at 760mmHg |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.43100 |
| Flash Point | 218.1ºC |
| Exact Mass | 307.22600 |
| PSA | 58.80000 |
| LogP | 2.67050 |
| Index of Refraction | 1.536 |
| InChIKey | GFFFJSWQOUVZCY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN(CC)CCOC(=O)c1ccc(N)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-[2-diethylaminoethyl(ethyl)amino]ethyl 4-aminobenzoate |
| 1-[ethyl-(2-diethylamino-ethyl)-amino]-2-(4-amino-benzoyloxy)-ethane |
| 4-aminobenzoic acid 2-[2-diethylaminoethyl(ethyl)amino]ethyl ester |
| 1-[Aethyl-(2-diaethylamino-aethyl)-amino]-2-(4-amino-benzoyloxy)-aethan |
| N,N',N'-Triaethyl-N-[2-(4-amino-benzoyloxy)-aethyl]-aethylendiamin |
| p-Aminobenzoic acid 2-[[2-(diethylamino)ethyl]ethylamino]ethyl ester |
| 2-[2-diethylaminoethyl(ethyl)amino]ethyl 4-azanylbenzoate |