Benzenamine,N,N-bis(2-chloroethyl)-3-methyl-4-nitroso-
Modify Date: 2025-09-25 19:01:51
Benzenamine,N,N-bis(2-chloroethyl)-3-methyl-4-nitroso- structure
|
Common Name | Benzenamine,N,N-bis(2-chloroethyl)-3-methyl-4-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 5520-25-2 | Molecular Weight | 261.14800 | |
| Density | 1.23g/cm3 | Boiling Point | 409.4ºC at 760 mmHg | |
| Molecular Formula | C11H14Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.4ºC | |
| Name | N,N-bis(2-chloroethyl)-3-methyl-4-nitrosoaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 409.4ºC at 760 mmHg |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.14800 |
| Flash Point | 201.4ºC |
| Exact Mass | 260.04800 |
| PSA | 32.67000 |
| LogP | 3.67690 |
| Index of Refraction | 1.551 |
| InChIKey | JGHUXJOHWMMZFC-UHFFFAOYSA-N |
| SMILES | Cc1cc(N(CCCl)CCCl)ccc1N=O |
|
~%
Benzenamine,N,N... CAS#:5520-25-2 |
| Literature: Ross et al. Journal of the Chemical Society, 1955 , p. 3110,3115 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![1-[4-[bis(2-chloroethyl)amino]-2-methyl-phenyl]-3-phenyl-urea structure](https://image.chemsrc.com/caspic/285/76109-97-2.png)
CAS#:76109-97-2| 4-Nitroso-3-methyl-N,N-bis-<2-chlorethyl>-anilin |