b-D-Ribofuranoside, methyl2,3-O-carbonyl-, benzoate (9CI)
Modify Date: 2025-11-25 17:59:40
b-D-Ribofuranoside, methyl2,3-O-carbonyl-, benzoate (9CI) structure
|
Common Name | b-D-Ribofuranoside, methyl2,3-O-carbonyl-, benzoate (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5517-62-4 | Molecular Weight | 294.25700 | |
| Density | 1.39g/cm3 | Boiling Point | 487.7ºC at 760 mmHg | |
| Molecular Formula | C14H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.7ºC | |
| Name | (4-methoxy-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl benzoate |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 487.7ºC at 760 mmHg |
| Molecular Formula | C14H14O7 |
| Molecular Weight | 294.25700 |
| Flash Point | 219.7ºC |
| Exact Mass | 294.07400 |
| PSA | 80.29000 |
| LogP | 1.11870 |
| Index of Refraction | 1.562 |
| InChIKey | QEJNCDMZMCHLCH-UHFFFAOYSA-N |
| SMILES | COC1OC(COC(=O)c2ccccc2)C2OC(=O)OC12 |
|
~%
b-D-Ribofuranos... CAS#:5517-62-4 |
| Literature: Wright et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 2004 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |