4-Iodobenzoic acid phenacyl ester structure
|
Common Name | 4-Iodobenzoic acid phenacyl ester | ||
|---|---|---|---|---|
| CAS Number | 55153-29-2 | Molecular Weight | 366.15100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenacyl 4-iodobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11IO3 |
|---|---|
| Molecular Weight | 366.15100 |
| Exact Mass | 365.97500 |
| PSA | 43.37000 |
| LogP | 3.33090 |
| InChIKey | MLOLQUAQSPKDIW-UHFFFAOYSA-N |
| SMILES | O=C(COC(=O)c1ccc(I)cc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
4-Iodobenzoic a... CAS#:55153-29-2 |
| Literature: Kelly; Howard Journal of the American Chemical Society, 1932 , vol. 54, p. 4383 |
|
~%
4-Iodobenzoic a... CAS#:55153-29-2 |
| Literature: Pillay, M. Krishna; Kannan, K.; Ramasubramanian, P. Tetrahedron, 1983 , vol. 39, # 23 p. 3899 - 3908 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Jod-benzoesaeure-phenacylester |
| Phenacyl-p-jodbenzoat |
| CCG-583 |
| 4-Iodobenzoic acid phenacyl ester |