1,4:3,6-Dianhydro-D-mannitol dinitrate structure
|
Common Name | 1,4:3,6-Dianhydro-D-mannitol dinitrate | ||
|---|---|---|---|---|
| CAS Number | 551-43-9 | Molecular Weight | 236.136 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 365.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H8N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.6±29.9 °C | |
| Name | [(3R,3aS,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.9±42.0 °C at 760 mmHg |
| Molecular Formula | C6H8N2O8 |
| Molecular Weight | 236.136 |
| Flash Point | 186.6±29.9 °C |
| Exact Mass | 236.028061 |
| PSA | 128.56000 |
| LogP | 0.90 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | MOYKHGMNXAOIAT-KVTDHHQDSA-N |
| SMILES | O=[N+]([O-])OC1COC2C(O[N+](=O)[O-])COC12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4,3,6-Dianhydro-D-mannitol dinitrate |
| d-mannitol,1,4:3,6-dianhydro-,dinitrate |
| 1,4:3,6-Dianhydro-2,5-di-O-nitro-D-mannitol |
| Isomannide dinitrate |
| D-Mannitol, 1,4:3,6-dianhydro-, dinitrate |