1-[1-(3,4-Dimethoxyphenyl)cyclohexyl]methanamine
Modify Date: 2025-10-04 13:28:59
![1-[1-(3,4-Dimethoxyphenyl)cyclohexyl]methanamine Structure](https://image.chemsrc.com/caspic/093/55092-70-1.png)
1-[1-(3,4-Dimethoxyphenyl)cyclohexyl]methanamine structure
|
Common Name | 1-[1-(3,4-Dimethoxyphenyl)cyclohexyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 55092-70-1 | Molecular Weight | 249.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[1-(3,4-Dimethoxyphenyl)cyclohexyl]methanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23NO2 |
|---|---|
| Molecular Weight | 249.34900 |
| Exact Mass | 249.17300 |
| PSA | 44.48000 |
| LogP | 3.56470 |
| InChIKey | YQWMHCBHGKRRPV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(CN)CCCCC2)cc1OC |
| HS Code | 2922299090 |
|---|
|
~91%
1-[1-(3,4-Dimet... CAS#:55092-70-1 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED? Patent: WO2005/35514 A2, 2005 ; Location in patent: Page/Page column 115-116 ; WO 2005/035514 A2 |
|
~%
1-[1-(3,4-Dimet... CAS#:55092-70-1 |
| Literature: Hoffmann-La Roche Inc. Patent: US5302727 A1, 1994 ; |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(3,4-Dimethoxy-phenaethyl)-pyrrolidin-2-on |
| C-[1-(3,4-dimethoxy-phenyl)-cyclohexyl]-methylamine |
| 1-(3,4-dimethoxyphenyl)-1-cyclohexanemethanamine |
| 1-(3,4-Dimethoxyphenyl)-1-aminomethylcyclohexan |
| N-[2-(3,4-dimethoxyphenyl)ethyl]-2-pyrrolidone |
| 1-(3,4-Dimethoxyphenaethyl)-2-pyrrolidinon |
| 2-Pyrrolidinone,1-[2-(3,4-dimethoxyphenyl)ethyl] |
| 1-(3,4-dimethoxy-phenethyl)-pyrrolidin-2-one |