methyl 3-(5-methoxycarbonyl-2-methylphenyl)-4-methylbenzoate
Modify Date: 2025-12-01 11:22:36
methyl 3-(5-methoxycarbonyl-2-methylphenyl)-4-methylbenzoate structure
|
Common Name | methyl 3-(5-methoxycarbonyl-2-methylphenyl)-4-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 55091-49-1 | Molecular Weight | 298.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-(5-methoxycarbonyl-2-methylphenyl)-4-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18O4 |
|---|---|
| Molecular Weight | 298.33300 |
| Exact Mass | 298.12100 |
| PSA | 52.60000 |
| LogP | 3.54360 |
| InChIKey | TZCIKGUXQHNNPX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C)c(-c2cc(C(=O)OC)ccc2C)c1 |
|
~78%
methyl 3-(5-met... CAS#:55091-49-1 |
| Literature: Kar, Anirban; Mangu, Naveenkumar; Kaiser, Hanns Martin; Tse, Man Kin Journal of Organometallic Chemistry, 2009 , vol. 694, # 4 p. 524 - 537 |
|
~%
methyl 3-(5-met... CAS#:55091-49-1 |
| Literature: Kenner; Witham Journal of the Chemical Society, 1913 , vol. 103, p. 236 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| [1,1'-Biphenyl]-3,3'-dicarboxylic acid,6,6'-dimethyl-,dimethyl ester |
| 5,5'-dicarbomethoxy-2,2'-dimethylbiphenyl |
| 6,6'-dimethyl-biphenyl-3,3'-dicarboxylic acid dimethyl ester |
| 6,6'-Dimethyl-biphenyl-3,3'-dicarbonsaeure-dimethylester |
| dimethyl 6,6'-dimethylbiphenyl-3,3'-dicarboxylate |