Benzenesulfinic acid, 2-Methyl-, compd. with 7-oxa-2-azaspiro[3.5]nonane (1:1) structure
|
Common Name | Benzenesulfinic acid, 2-Methyl-, compd. with 7-oxa-2-azaspiro[3.5]nonane (1:1) | ||
|---|---|---|---|---|
| CAS Number | 550369-43-2 | Molecular Weight | 283.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methylbenzenesulfinic acid-7-oxa-2-azaspiro[3.5]nonane (1:1) |
|---|
| Molecular Formula | C14H21NO3S |
|---|---|
| Molecular Weight | 283.38600 |
| Exact Mass | 283.12400 |
| PSA | 77.77000 |
| LogP | 3.15650 |
| InChIKey | YZYORSOMCYMIFM-UHFFFAOYSA-N |
| SMILES | C1CC2(CCO1)CNC2.Cc1ccccc1S(=O)O |