(3-Methoxyphenyl)2-pyridinylmethanone structure
|
Common Name | (3-Methoxyphenyl)2-pyridinylmethanone | ||
|---|---|---|---|---|
| CAS Number | 55030-49-4 | Molecular Weight | 213.23200 | |
| Density | 1.154g/cm3 | Boiling Point | 370.811ºC at 760 mmHg | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.06ºC | |
| Name | (3-methoxyphenyl)-pyridin-2-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 370.811ºC at 760 mmHg |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23200 |
| Flash Point | 178.06ºC |
| Exact Mass | 213.07900 |
| PSA | 39.19000 |
| LogP | 2.32120 |
| Index of Refraction | 1.572 |
| InChIKey | YBVDKZSACQCHFA-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)c2ccccn2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3-METHOXYBENZOYL)PYRIDINE |
| 2-pyridyl 3-methoxyphenyl ketone |
| (3-methoxyphenyl)-pyridin-2-yl-methanone |
| (3-methoxyphenyl)-2-pyridylmethanone |
| m-Methoxyphenyl-2-pyridyl-keton |