(R)-(+)-3,3-DIFLUORO-1,2-HEPTANEDIOL structure
|
Common Name | (R)-(+)-3,3-DIFLUORO-1,2-HEPTANEDIOL | ||
|---|---|---|---|---|
| CAS Number | 54996-33-7 | Molecular Weight | 226.26900 | |
| Density | 1.202g/cm3 | Boiling Point | 444.3ºC at 760 mmHg | |
| Molecular Formula | C12H18O4 | Melting Point | 40-43ºC(lit.) | |
| MSDS | USA | Flash Point | >230 °F | |
| Name | 7-[(3R)-3-hydroxy-5-oxocyclopenten-1-yl]heptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 444.3ºC at 760 mmHg |
| Melting Point | 40-43ºC(lit.) |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.26900 |
| Flash Point | >230 °F |
| Exact Mass | 226.12100 |
| PSA | 74.60000 |
| LogP | 1.67170 |
| Index of Refraction | 1.533 |
| InChIKey | IXOFUWJRSYPKSX-JTQLQIEISA-N |
| SMILES | O=C(O)CCCCCCC1=CC(O)CC1=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (R)-(+)-3-Hydroxy-5-oxo-1-cyclopentene-1-heptanoic acid |
| I04-9754 |
| MFCD00799552 |