2,3,4,5-Tetrahydro-1-[2-(diisopropylamino)ethyl]-8-methoxy-1H-1-benzazepin-2-one structure
|
Common Name | 2,3,4,5-Tetrahydro-1-[2-(diisopropylamino)ethyl]-8-methoxy-1H-1-benzazepin-2-one | ||
|---|---|---|---|---|
| CAS Number | 54951-31-4 | Molecular Weight | 318.45400 | |
| Density | 1.026g/cm3 | Boiling Point | 491.4ºC at 760 mmHg | |
| Molecular Formula | C19H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251ºC | |
| Name | 1-[2-[di(propan-2-yl)amino]ethyl]-8-methoxy-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.026g/cm3 |
|---|---|
| Boiling Point | 491.4ºC at 760 mmHg |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.45400 |
| Flash Point | 251ºC |
| Exact Mass | 318.23100 |
| PSA | 32.78000 |
| LogP | 3.54830 |
| Index of Refraction | 1.519 |
| InChIKey | WUUPKSODGWXAMQ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)N(CCN(C(C)C)C(C)C)C(=O)CCC2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-diisopropylamino-ethyl)-8-methoxy-1,3,4,5-tetrahydro-benzo[b]azepin-2-one |
| 1H-1-Benzazepin-2-one,2,3,4,5-tetrahydro-1-(2-(diisopropylamino)ethyl)-8-methoxy |
| 1H-1-Benzazepin-2-one,1-(2-(diisopropylamino)ethyl)-8-methoxy-2,3,4,5-tetrahydro |