1,4-diphenylpiperidine-2,6-dione
Modify Date: 2025-09-21 16:47:50
1,4-diphenylpiperidine-2,6-dione structure
|
Common Name | 1,4-diphenylpiperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 54946-32-6 | Molecular Weight | 265.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-diphenylpiperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO2 |
|---|---|
| Molecular Weight | 265.30700 |
| Exact Mass | 265.11000 |
| PSA | 37.38000 |
| LogP | 3.18880 |
| InChIKey | KFVVVXVEQMFLQS-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)CC(=O)N1c1ccccc1 |
|
~%
1,4-diphenylpip... CAS#:54946-32-6 |
| Literature: Avery; Bouton American Chemical Journal, 1898 , vol. 20, p. 513 |
|
~%
1,4-diphenylpip... CAS#:54946-32-6 |
| Literature: Mallard; Wilson Journal of the American Pharmaceutical Association (1912-1977), 1957 , vol. 46, p. 176 |
|
~%
1,4-diphenylpip... CAS#:54946-32-6 |
| Literature: Avery; Bouton American Chemical Journal, 1898 , vol. 20, p. 513 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-diphenyldihydro-2,6(1H,3H)-pyridinedione |
| 1,4-diphenyl-piperidine-2,6-dione |
| HMS2790K22 |
| 3,6-Diphenyl-glutarimid |
| 1,4-Diphenyl-piperidin-2,6-dion |