Ethyl-3 (3,5-dimethoxy) phenyl ethyl propanoate structure
|
Common Name | Ethyl-3 (3,5-dimethoxy) phenyl ethyl propanoate | ||
|---|---|---|---|---|
| CAS Number | 54901-09-6 | Molecular Weight | 238.280 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 335.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.7±23.8 °C | |
| Name | Ethyl 3-(3,5-dimethoxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.6±27.0 °C at 760 mmHg |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.280 |
| Flash Point | 145.7±23.8 °C |
| Exact Mass | 238.120514 |
| PSA | 44.76000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | NKOHJJUVRVNYPI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1cc(OC)cc(OC)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethyl 3-(3,5-dimethoxyphenyl)propanoate |
| Benzenepropanoic acid, 3,5-dimethoxy-, ethyl ester |
| Ethyl-3 (3,5-dimethoxy) phenyl ethyl propanoate |