2-amino-4-benzyl-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile structure
|
Common Name | 2-amino-4-benzyl-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 5490-57-3 | Molecular Weight | 280.32100 | |
| Density | 1.27g/cm3 | Boiling Point | 546.6ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.4ºC | |
| Name | 2-amino-4-benzyl-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 546.6ºC at 760 mmHg |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.32100 |
| Flash Point | 284.4ºC |
| Exact Mass | 280.12100 |
| PSA | 76.11000 |
| LogP | 3.27678 |
| Index of Refraction | 1.625 |
| InChIKey | JKWLATNBIZZMCQ-UHFFFAOYSA-N |
| SMILES | N#CC1=C(N)OC2=C(C(=O)CCC2)C1Cc1ccccc1 |
|
~%
2-amino-4-benzy... CAS#:5490-57-3 |
| Literature: Cooper,D.J.; Owen,L.N. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 533 - 540 |
|
~%
2-amino-4-benzy... CAS#:5490-57-3 |
| Literature: Cooper,D.J.; Owen,L.N. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 533 - 540 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Amino-4-benzyl-5-oxo-5,6,7,8-tetrahydro-4H-chromene-3-carbonitrile |
| Phosphorsaeure-diaethyl-<2-brom-1,2-dichlor-1-phenyl-aethyl>-ester |