Stictic Acid
Modify Date: 2025-08-25 19:32:22
Stictic Acid structure
|
Common Name | Stictic Acid | ||
|---|---|---|---|---|
| CAS Number | 549-06-4 | Molecular Weight | 386.31 | |
| Density | 1.591g/cm3 | Boiling Point | 744.1ºC at 760mmHg | |
| Molecular Formula | C19H14O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.2ºC | |
Use of Stictic AcidStictic acid is a secondary metabolite that can be isolated from the lichen Lobaria pulmonaria (L.) Hoffm. Stictic acid inhibits growth of human colon adenocarcinoma HT-29 cells (IC50: 29.29 μg/mL)[1]. |
| Name | stictic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Stictic acid is a secondary metabolite that can be isolated from the lichen Lobaria pulmonaria (L.) Hoffm. Stictic acid inhibits growth of human colon adenocarcinoma HT-29 cells (IC50: 29.29 μg/mL)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.591g/cm3 |
|---|---|
| Boiling Point | 744.1ºC at 760mmHg |
| Molecular Formula | C19H14O9 |
| Molecular Weight | 386.31 |
| Flash Point | 273.2ºC |
| Exact Mass | 386.06400 |
| PSA | 128.59000 |
| LogP | 2.31630 |
| Index of Refraction | 1.692 |
| InChIKey | SKCUFZLDTAYNBZ-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c2c(c1C=O)Oc1c(c(C)c(O)c3c1C(O)OC3=O)OC2=O |
| scopularic acid |
| stereocaulonic acid |