4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]aniline structure
|
Common Name | 4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]aniline | ||
|---|---|---|---|---|
| CAS Number | 54883-32-8 | Molecular Weight | 286.77900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11ClN2S |
|---|---|
| Molecular Weight | 286.77900 |
| Exact Mass | 286.03300 |
| PSA | 67.15000 |
| LogP | 5.29390 |
| InChIKey | LWHSCOLOVKIXEP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2csc(-c3ccc(Cl)cc3)n2)cc1 |
|
~%
4-[2-(4-chlorop... CAS#:54883-32-8 |
| Literature: Sawhney,S.N. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1978 , vol. 16, p. 521 - 523 |
|
~%
4-[2-(4-chlorop... CAS#:54883-32-8 |
| Literature: Patil; Ingle Journal of the Indian Chemical Society, 1979 , vol. 56, # 12 p. 1243 - 1245 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-[2-(4-chloro-phenyl)-thiazol-4-yl]-aniline |
| F2158-1135 |
| 2-p-Chlorphenyl-4-(4'-aminophenyl)thiazol |
| Benzenamine,4-[2-(4-chlorophenyl)-4-thiazolyl] |
| 2-p-Chlorphenyl-4-(p-aminophenyl)thiazole |