4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione structure
|
Common Name | 4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5488-36-8 | Molecular Weight | 189.21100 | |
| Density | 1.155g/cm3 | Boiling Point | 357.8ºC at 760 mmHg | |
| Molecular Formula | C11H11NO2 | Melting Point | 105-109 °C | |
| MSDS | N/A | Flash Point | 158.1ºC | |
| Name | 4,4-dimethylisoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 357.8ºC at 760 mmHg |
| Melting Point | 105-109 °C |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21100 |
| Flash Point | 158.1ºC |
| Exact Mass | 189.07900 |
| PSA | 46.17000 |
| LogP | 1.56300 |
| Index of Refraction | 1.539 |
| InChIKey | VSRVOIDBBCKMTM-UHFFFAOYSA-N |
| SMILES | CC1(C)C(=O)NC(=O)c2ccccc21 |
| Storage condition | 2-8°C |
| HS Code | 2933499090 |
|---|
|
~%
4,4-dimethyl-1,... CAS#:5488-36-8 |
| Literature: Takechi, Haruko; Takahashi, Hajime; Machida, Minoru Journal of Heterocyclic Chemistry, 2005 , vol. 42, # 2 p. 201 - 207 |
|
~%
4,4-dimethyl-1,... CAS#:5488-36-8 |
| Literature: Gabriel Chemische Berichte, 1886 , vol. 19, p. 2363 Chemische Berichte, 1887 , vol. 20, p. 1199 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4-dimethyl-1,3-dioxoisoquinoline |
| 4,4-dimethyl-2H-3,4-dihydro-isoquinolin-1,3-dione |
| 4,4-dimethyl-2H,4H-isoquinoline-1,3-dione |
| 4,4-dimethylhomophthalimide |
| 4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione |
| 4,4-dimethyl-4H-isoquinoline-1,3-dione |