N-(4-hydroxyphenyl)cyclohexanecarboxamide
Modify Date: 2025-10-01 19:22:55
N-(4-hydroxyphenyl)cyclohexanecarboxamide structure
|
Common Name | N-(4-hydroxyphenyl)cyclohexanecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 548763-46-8 | Molecular Weight | 219.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-hydroxyphenyl)cyclohexanecarboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28000 |
| Exact Mass | 219.12600 |
| PSA | 49.33000 |
| LogP | 2.98400 |
| InChIKey | SPELRQCTCINJTP-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(O)cc1)C1CCCCC1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-hydroxyphe... CAS#:548763-46-8 |
| Literature: Cho, Jun-Cheol; Rho, Ho Sik; Joo, Yung Hyup; Ahn, Soo Mi; Won, Doo Hyun; Shin, Song Seok; Park, Young-Ho; Suh, Kyung-Do; Park, Soo Nam Bulletin of the Korean Chemical Society, 2012 , vol. 33, # 4 p. 1333 - 1336 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclohexanecarboxylic acid (4-hydroxy-phenyl)-amide |
| N-(4-HYDROXYPHENYL)CYCLOHEXANE CARBOXAMIDE |
| cyclohexanecarboxylic acid (4-hydroxyphenyl)-amide |