1-methylselanyl-3-nitrobenzene
Modify Date: 2025-08-26 12:06:27
1-methylselanyl-3-nitrobenzene structure
|
Common Name | 1-methylselanyl-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 54864-38-9 | Molecular Weight | 216.09600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7NO2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methylselanyl-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7NO2Se |
|---|---|
| Molecular Weight | 216.09600 |
| Exact Mass | 216.96400 |
| PSA | 45.82000 |
| LogP | 1.49560 |
| InChIKey | OYCATYCPKANQLD-UHFFFAOYSA-N |
| SMILES | C[Se]C1=CC=CC(=C1)[N+](=O)[O-] |
|
~%
1-methylselanyl... CAS#:54864-38-9 |
| Literature: Baker; Moffitt Journal of the Chemical Society, 1930 , p. 1722,1725 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:70086-66-7| Benzene,1-(methylseleno)-3-nitro |
| Methyl-<3-nitro-phenyl>-selenid |
| 3-Nitro-1-methylseleno-benzol |
| <m-Nitro-phenyl>-methyl-selenid |
| methyl-(3-nitro-phenyl)-selenide |
| 3-nitro-selenoanisol |