methyl 2,6-dichloro-3-methoxybenzoate
Modify Date: 2025-10-11 17:56:34
methyl 2,6-dichloro-3-methoxybenzoate structure
|
Common Name | methyl 2,6-dichloro-3-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 54810-64-9 | Molecular Weight | 235.06400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2,6-dichloro-3-methoxybenzoate |
|---|
| Molecular Formula | C9H8Cl2O3 |
|---|---|
| Molecular Weight | 235.06400 |
| Exact Mass | 233.98500 |
| PSA | 35.53000 |
| LogP | 2.78860 |
| InChIKey | JNVDRHPOEZWRHN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(Cl)ccc(OC)c1Cl |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |